C16H13Br2FO — CID 63442604
5-[bromo-(2-bromo-4-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1-benzofuran (PubChem CID 63442604) has the molecular formula C16H13Br2FO and a molecular weight of 400.09 g/mol. Its IUPAC name is 5-[bromo-(2-bromo-4-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1-benzofuran.
| Compound Name | 5-[bromo-(2-bromo-4-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 63442604 |
| Molecular Formula | C16H13Br2FO |
| Molecular Weight | 400.09 g/mol |
| Exact Mass | 397.93 |
| IUPAC Name | 5-[bromo-(2-bromo-4-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1-benzofuran |
| SMILES | CC1Cc2cc(C(Br)c3ccc(F)cc3Br)ccc2O1 |
| InChI | InChI=1S/C16H13Br2FO/c1-9-6-11-7-10(2-5-15(11)20-9)16(18)13-4-3-12(19)8-14(13)17/h2-5,7-9,16H,6H2,1H3 |
| InChIKey | IOQMKRMOORANMP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.09 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|