C22H23NO6 — CID 6352911
(2S,3R)-2-[(7-hydroxy-4-oxo-3-phenoxychromen-8-yl)methylamino]-3-methylpentanoic acid (PubChem CID 6352911) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is (2S,3R)-2-[(7-hydroxy-4-oxo-3-phenoxychromen-8-yl)methylamino]-3-methylpentanoic acid.
| Compound Name | (2S,3R)-2-[(7-hydroxy-4-oxo-3-phenoxychromen-8-yl)methylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 6352911 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (2S,3R)-2-[(7-hydroxy-4-oxo-3-phenoxychromen-8-yl)methylamino]-3-methylpentanoic acid |
| SMILES | CC[C@@H](C)[C@H](NCc1c(O)ccc2c(=O)c(Oc3ccccc3)coc12)C(=O)O |
| InChI | InChI=1S/C22H23NO6/c1-3-13(2)19(22(26)27)23-11-16-17(24)10-9-15-20(25)18(12-28-21(15)16)29-14-7-5-4-6-8-14/h4-10,12-13,19,23-24H,3,11H2,1-2H3,(H,26,27)/t13-,19+/m1/s1 |
| InChIKey | IJAAWTXJFCQYFT-YJYMSZOUSA-N |
| XLogP | 3.88 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|