C22H21Cl2NO6 — CID 38990191
(2R,3S)-2-[[3-(2,4-dichlorophenoxy)-7-hydroxy-4-oxochromen-8-yl]methylamino]-3-methylpentanoic acid (PubChem CID 38990191) has the molecular formula C22H21Cl2NO6 and a molecular weight of 466.32 g/mol. Its IUPAC name is (2R,3S)-2-[[3-(2,4-dichlorophenoxy)-7-hydroxy-4-oxochromen-8-yl]methylamino]-3-methylpentanoic acid.
| Compound Name | (2R,3S)-2-[[3-(2,4-dichlorophenoxy)-7-hydroxy-4-oxochromen-8-yl]methylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 38990191 |
| Molecular Formula | C22H21Cl2NO6 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | (2R,3S)-2-[[3-(2,4-dichlorophenoxy)-7-hydroxy-4-oxochromen-8-yl]methylamino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@@H](NCc1c(O)ccc2c(=O)c(Oc3ccc(Cl)cc3Cl)coc12)C(=O)O |
| InChI | InChI=1S/C22H21Cl2NO6/c1-3-11(2)19(22(28)29)25-9-14-16(26)6-5-13-20(27)18(10-30-21(13)14)31-17-7-4-12(23)8-15(17)24/h4-8,10-11,19,25-26H,3,9H2,1-2H3,(H,28,29)/t11-,19+/m0/s1 |
| InChIKey | BUOQBVVJGXVRDI-JEOXALJRSA-N |
| XLogP | 5.19 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|