C10H5Br2Cl2N — CID 63530380
6,8-dibromo-2-chloro-3-(chloromethyl)quinoline (PubChem CID 63530380) has the molecular formula C10H5Br2Cl2N and a molecular weight of 369.87 g/mol. Its IUPAC name is 6,8-dibromo-2-chloro-3-(chloromethyl)quinoline.
| Compound Name | 6,8-dibromo-2-chloro-3-(chloromethyl)quinoline |
|---|---|
| PubChem CID | 63530380 |
| Molecular Formula | C10H5Br2Cl2N |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 366.82 |
| IUPAC Name | 6,8-dibromo-2-chloro-3-(chloromethyl)quinoline |
| SMILES | ClCc1cc2cc(Br)cc(Br)c2nc1Cl |
| InChI | InChI=1S/C10H5Br2Cl2N/c11-7-2-5-1-6(4-13)10(14)15-9(5)8(12)3-7/h1-3H,4H2 |
| InChIKey | UHSPLKZJQKDGFA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|