C16H20ClNO2 — CID 63533081
7-chloro-1-(2-ethylhexyl)indole-2,3-dione (PubChem CID 63533081) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is 7-chloro-1-(2-ethylhexyl)indole-2,3-dione.
| Compound Name | 7-chloro-1-(2-ethylhexyl)indole-2,3-dione |
|---|---|
| PubChem CID | 63533081 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 7-chloro-1-(2-ethylhexyl)indole-2,3-dione |
| SMILES | CCCCC(CC)CN1C(=O)C(=O)c2cccc(Cl)c21 |
| InChI | InChI=1S/C16H20ClNO2/c1-3-5-7-11(4-2)10-18-14-12(15(19)16(18)20)8-6-9-13(14)17/h6,8-9,11H,3-5,7,10H2,1-2H3 |
| InChIKey | OMBPEQFBTMZILT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|