C17H18BrNO — CID 63541257
(1R)-1-[3-bromo-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]ethanol (PubChem CID 63541257) has the molecular formula C17H18BrNO and a molecular weight of 332.24 g/mol. Its IUPAC name is (1R)-1-[3-bromo-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]ethanol.
| Compound Name | (1R)-1-[3-bromo-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 63541257 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | (1R)-1-[3-bromo-4-(2-methyl-2,3-dihydroindol-1-yl)phenyl]ethanol |
| SMILES | CC1Cc2ccccc2N1c1ccc([C@@H](C)O)cc1Br |
| InChI | InChI=1S/C17H18BrNO/c1-11-9-14-5-3-4-6-16(14)19(11)17-8-7-13(12(2)20)10-15(17)18/h3-8,10-12,20H,9H2,1-2H3/t11?,12-/m1/s1 |
| InChIKey | MWAKRIRCSPUOLT-PIJUOVFKSA-N |
| XLogP | 4.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |