C9H17N5O — CID 63577839
2-(3,5-dimethyl-1,2,4-triazol-1-yl)-3-methylbutanehydrazide (PubChem CID 63577839) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2,4-triazol-1-yl)-3-methylbutanehydrazide.
| Compound Name | 2-(3,5-dimethyl-1,2,4-triazol-1-yl)-3-methylbutanehydrazide |
|---|---|
| PubChem CID | 63577839 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2-(3,5-dimethyl-1,2,4-triazol-1-yl)-3-methylbutanehydrazide |
| SMILES | Cc1nc(C)n(C(C(=O)NN)C(C)C)n1 |
| InChI | InChI=1S/C9H17N5O/c1-5(2)8(9(15)12-10)14-7(4)11-6(3)13-14/h5,8H,10H2,1-4H3,(H,12,15) |
| InChIKey | YQCBSFUQFSAIFS-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|