C9H18N2O4S — CID 63608305
4-(2-methoxyethylsulfonyl)-3,3-dimethylpiperazin-2-one (PubChem CID 63608305) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is 4-(2-methoxyethylsulfonyl)-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-(2-methoxyethylsulfonyl)-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 63608305 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 4-(2-methoxyethylsulfonyl)-3,3-dimethylpiperazin-2-one |
| SMILES | COCCS(=O)(=O)N1CCNC(=O)C1(C)C |
| InChI | InChI=1S/C9H18N2O4S/c1-9(2)8(12)10-4-5-11(9)16(13,14)7-6-15-3/h4-7H2,1-3H3,(H,10,12) |
| InChIKey | VYHYDWRZGNEJCZ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |