C10H20N2O4S — CID 55216322
4-(2-ethoxyethylsulfonyl)-3,3-dimethylpiperazin-2-one (PubChem CID 55216322) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-(2-ethoxyethylsulfonyl)-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-(2-ethoxyethylsulfonyl)-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 55216322 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-(2-ethoxyethylsulfonyl)-3,3-dimethylpiperazin-2-one |
| SMILES | CCOCCS(=O)(=O)N1CCNC(=O)C1(C)C |
| InChI | InChI=1S/C10H20N2O4S/c1-4-16-7-8-17(14,15)12-6-5-11-9(13)10(12,2)3/h4-8H2,1-3H3,(H,11,13) |
| InChIKey | AXERESHSIKKQEC-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|