C18H22N2O2S — CID 6368598
4-methyl-N-[(E)-spiro[5.5]undeca-4,9-dien-3-ylideneamino]benzenesulfonamide (PubChem CID 6368598) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is 4-methyl-N-[(E)-spiro[5.5]undeca-4,9-dien-3-ylideneamino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(E)-spiro[5.5]undeca-4,9-dien-3-ylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 6368598 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 4-methyl-N-[(E)-spiro[5.5]undeca-4,9-dien-3-ylideneamino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2/C=CC3(CC=CCC3)CC2)cc1 |
| InChI | InChI=1S/C18H22N2O2S/c1-15-5-7-17(8-6-15)23(21,22)20-19-16-9-13-18(14-10-16)11-3-2-4-12-18/h2-3,5-9,13,20H,4,10-12,14H2,1H3/b19-16- |
| InChIKey | DCCIVMNOLZRSIS-MNDPQUGUSA-N |
| XLogP | 3.71 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|