C6H12BF3NO2S- — CID 63703311
[(1,1-dioxothiolan-3-yl)-methylamino]methyl-trifluoroboranuide (PubChem CID 63703311) has the molecular formula C6H12BF3NO2S- and a molecular weight of 230.04 g/mol. Its IUPAC name is [(1,1-dioxothiolan-3-yl)-methylamino]methyl-trifluoroboranuide.
| Compound Name | [(1,1-dioxothiolan-3-yl)-methylamino]methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 63703311 |
| Molecular Formula | C6H12BF3NO2S- |
| Molecular Weight | 230.04 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | [(1,1-dioxothiolan-3-yl)-methylamino]methyl-trifluoroboranuide |
| SMILES | CN(C[B-](F)(F)F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H12BF3NO2S/c1-11(5-7(8,9)10)6-2-3-14(12,13)4-6/h6H,2-5H2,1H3/q-1 |
| InChIKey | PUWRPSILQRNHMI-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.04 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|