C24H25N9O2S — CID 6370606
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]amino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide (PubChem CID 6370606) has the molecular formula C24H25N9O2S and a molecular weight of 503.59 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]amino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]amino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 6370606 |
| Molecular Formula | C24H25N9O2S |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]amino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide |
| SMILES | CC(/C=C/c1ccc(N(C)C)cc1)=N/NC(=O)c1nnn(-c2nonc2N)c1CSc1ccccc1 |
| InChI | InChI=1S/C24H25N9O2S/c1-16(9-10-17-11-13-18(14-12-17)32(2)3)26-28-24(34)21-20(15-36-19-7-5-4-6-8-19)33(31-27-21)23-22(25)29-35-30-23/h4-14H,15H2,1-3H3,(H2,25,29)(H,28,34)/b10-9+,26-16- |
| InChIKey | DXCDENOQDOMOBZ-NHCWNVEMSA-N |
| XLogP | 3.41 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|