C17H16N2S — CID 63738985
2-(1-benzothiophen-3-ylmethyl)-1,3-dihydroisoindol-4-amine (PubChem CID 63738985) has the molecular formula C17H16N2S and a molecular weight of 280.40 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-ylmethyl)-1,3-dihydroisoindol-4-amine.
| Compound Name | 2-(1-benzothiophen-3-ylmethyl)-1,3-dihydroisoindol-4-amine |
|---|---|
| PubChem CID | 63738985 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-(1-benzothiophen-3-ylmethyl)-1,3-dihydroisoindol-4-amine |
| SMILES | Nc1cccc2c1CN(Cc1csc3ccccc13)C2 |
| InChI | InChI=1S/C17H16N2S/c18-16-6-3-4-12-8-19(10-15(12)16)9-13-11-20-17-7-2-1-5-14(13)17/h1-7,11H,8-10,18H2 |
| InChIKey | YSAMALPROYBQOI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|