About 3-bromo-1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]pyrrolidin-2-one
3-bromo-1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]pyrrolidin-2-one (PubChem CID 63788049) has the molecular formula C14H16BrNO3
and a molecular weight of 326.19 g/mol. Its IUPAC name is 3-bromo-1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-bromo-1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]pyrrolidin-2-one |
| PubChem CID | 63788049 |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 3-bromo-1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]pyrrolidin-2-one |
| SMILES | O=C1C(Br)CCN1CCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H16BrNO3/c15-11-4-6-16(14(11)17)5-3-10-1-2-12-13(9-10)19-8-7-18-12/h1-2,9,11H,3-8H2 |
| InChIKey | ZVHTYDQWMXJRMN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]pyrrolidin-2-one?
The IUPAC name of 3-bromo-1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]pyrrolidin-2-one (CID 63788049) is 3-bromo-1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]pyrrolidin-2-one.
What is the SMILES notation for 3-bromo-1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]pyrrolidin-2-one?
The canonical SMILES for 3-bromo-1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]pyrrolidin-2-one is O=C1C(Br)CCN1CCc1ccc2c(c1)OCCO2.
What is the InChIKey of 3-bromo-1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]pyrrolidin-2-one?
The InChIKey is ZVHTYDQWMXJRMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrNO3/c15-11-4-6-16(14(11)17)5-3-10-1-2-12-13(9-10)19-8-7-18-12/h1-2,9,11H,3-8H2.
What are the key properties of 3-bromo-1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]pyrrolidin-2-one?
3-bromo-1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]pyrrolidin-2-one has a molecular weight of 326.19 g/mol, XLogP of 2.00, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]pyrrolidin-2-one is sourced from PubChem (CID 63788049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).