C15H11ClF3N6O+ — CID 6386352
(4-amino-5-methyl-1,2,4-triazol-3-yl)imino-[[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]azanium (PubChem CID 6386352) has the molecular formula C15H11ClF3N6O+ and a molecular weight of 383.74 g/mol. Its IUPAC name is (4-amino-5-methyl-1,2,4-triazol-3-yl)imino-[[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]azanium.
| Compound Name | (4-amino-5-methyl-1,2,4-triazol-3-yl)imino-[[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]azanium |
|---|---|
| PubChem CID | 6386352 |
| Molecular Formula | C15H11ClF3N6O+ |
| Molecular Weight | 383.74 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (4-amino-5-methyl-1,2,4-triazol-3-yl)imino-[[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]azanium |
| SMILES | Cc1nnc(N=[N+]=Cc2ccc(-c3ccc(Cl)c(C(F)(F)F)c3)o2)n1N |
| InChI | InChI=1S/C15H11ClF3N6O/c1-8-22-24-14(25(8)20)23-21-7-10-3-5-13(26-10)9-2-4-12(16)11(6-9)15(17,18)19/h2-7H,1H3,(H2,20,23,24)/q+1 |
| InChIKey | FKAIHOVOTOIKFQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.74 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|