C17H18ClF3N3O+ — CID 9058658
(Z)-1-[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]-N-(4-methylpiperazin-4-ium-1-yl)methanimine (PubChem CID 9058658) has the molecular formula C17H18ClF3N3O+ and a molecular weight of 372.80 g/mol. Its IUPAC name is (Z)-1-[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]-N-(4-methylpiperazin-4-ium-1-yl)methanimine.
| Compound Name | (Z)-1-[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]-N-(4-methylpiperazin-4-ium-1-yl)methanimine |
|---|---|
| PubChem CID | 9058658 |
| Molecular Formula | C17H18ClF3N3O+ |
| Molecular Weight | 372.80 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (Z)-1-[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]-N-(4-methylpiperazin-4-ium-1-yl)methanimine |
| SMILES | C[NH+]1CCN(/N=C\c2ccc(-c3ccc(Cl)c(C(F)(F)F)c3)o2)CC1 |
| InChI | InChI=1S/C17H17ClF3N3O/c1-23-6-8-24(9-7-23)22-11-13-3-5-16(25-13)12-2-4-15(18)14(10-12)17(19,20)21/h2-5,10-11H,6-9H2,1H3/p+1/b22-11- |
| InChIKey | GQBOOAWZTLLYRT-JJFYIABZSA-O |
| XLogP | 2.78 |
| TPSA | 33.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.80 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|