C10H16N2 — CID 63970507
(E)-3-(1,2,5-trimethylpyrrol-3-yl)prop-2-en-1-amine (PubChem CID 63970507) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (E)-3-(1,2,5-trimethylpyrrol-3-yl)prop-2-en-1-amine.
| Compound Name | (E)-3-(1,2,5-trimethylpyrrol-3-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 63970507 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (E)-3-(1,2,5-trimethylpyrrol-3-yl)prop-2-en-1-amine |
| SMILES | Cc1cc(/C=C/CN)c(C)n1C |
| InChI | InChI=1S/C10H16N2/c1-8-7-10(5-4-6-11)9(2)12(8)3/h4-5,7H,6,11H2,1-3H3/b5-4+ |
| InChIKey | VVUPGHRSRJNYAF-SNAWJCMRSA-N |
| XLogP | 1.61 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |