C21H31NO3 — CID 640334
tert-butyl (4R,5S)-4-heptyl-2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate (PubChem CID 640334) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is tert-butyl (4R,5S)-4-heptyl-2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate.
| Compound Name | tert-butyl (4R,5S)-4-heptyl-2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 640334 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | tert-butyl (4R,5S)-4-heptyl-2-phenyl-4,5-dihydro-1,3-oxazole-5-carboxylate |
| SMILES | CCCCCCC[C@H]1N=C(c2ccccc2)O[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31NO3/c1-5-6-7-8-12-15-17-18(20(23)25-21(2,3)4)24-19(22-17)16-13-10-9-11-14-16/h9-11,13-14,17-18H,5-8,12,15H2,1-4H3/t17-,18+/m1/s1 |
| InChIKey | CIHPMJBIAUWGPB-MSOLQXFVSA-N |
| XLogP | 4.90 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|