C9H10Cl2F2 — CID 640444
(1R,6S)-1,6-dichloro-7,7-difluoro-3,4-dimethylbicyclo[4.1.0]hept-3-ene (PubChem CID 640444) has the molecular formula C9H10Cl2F2 and a molecular weight of 227.08 g/mol. Its IUPAC name is (1R,6S)-1,6-dichloro-7,7-difluoro-3,4-dimethylbicyclo[4.1.0]hept-3-ene.
| Compound Name | (1R,6S)-1,6-dichloro-7,7-difluoro-3,4-dimethylbicyclo[4.1.0]hept-3-ene |
|---|---|
| PubChem CID | 640444 |
| Molecular Formula | C9H10Cl2F2 |
| Molecular Weight | 227.08 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | (1R,6S)-1,6-dichloro-7,7-difluoro-3,4-dimethylbicyclo[4.1.0]hept-3-ene |
| SMILES | CC1=C(C)C[C@]2(Cl)C(F)(F)[C@]2(Cl)C1 |
| InChI | InChI=1S/C9H10Cl2F2/c1-5-3-7(10)8(11,4-6(5)2)9(7,12)13/h3-4H2,1-2H3/t7-,8+ |
| InChIKey | YGJSUTAXQYCQMI-OCAPTIKFSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.08 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|