About N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide
N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide (PubChem CID 6416529) has the molecular formula C30H37N3O2
and a molecular weight of 471.65 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide.
Molecular Properties
| Compound Name | N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide |
| PubChem CID | 6416529 |
| Molecular Formula | C30H37N3O2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide |
| SMILES | Cc1ccc(C)c(-c2nnc(OCC(=O)N(C3CCCCC3)C3CCCCC3)c3ccccc23)c1 |
| InChI | InChI=1S/C30H37N3O2/c1-21-17-18-22(2)27(19-21)29-25-15-9-10-16-26(25)30(32-31-29)35-20-28(34)33(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h9-10,15-19,23-24H,3-8,11-14,20H2,1-2H3 |
| InChIKey | CKBIUIJZJQHQJW-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide?
The IUPAC name of N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide (CID 6416529) is N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide.
What is the SMILES notation for N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide?
The canonical SMILES for N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide is Cc1ccc(C)c(-c2nnc(OCC(=O)N(C3CCCCC3)C3CCCCC3)c3ccccc23)c1.
What is the InChIKey of N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide?
The InChIKey is CKBIUIJZJQHQJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H37N3O2/c1-21-17-18-22(2)27(19-21)29-25-15-9-10-16-26(25)30(32-31-29)35-20-28(34)33(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h9-10,15-19,23-24H,3-8,11-14,20H2,1-2H3.
What are the key properties of N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide?
N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide has a molecular weight of 471.65 g/mol, XLogP of 6.79, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide is sourced from PubChem (CID 6416529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).