C30H37N3O2 — CID 6416529
N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide (PubChem CID 6416529) has the molecular formula C30H37N3O2 and a molecular weight of 471.65 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide.
| Compound Name | N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide |
|---|---|
| PubChem CID | 6416529 |
| Molecular Formula | C30H37N3O2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | N,N-dicyclohexyl-2-[4-(2,5-dimethylphenyl)phthalazin-1-yl]oxyacetamide |
| SMILES | Cc1ccc(C)c(-c2nnc(OCC(=O)N(C3CCCCC3)C3CCCCC3)c3ccccc23)c1 |
| InChI | InChI=1S/C30H37N3O2/c1-21-17-18-22(2)27(19-21)29-25-15-9-10-16-26(25)30(32-31-29)35-20-28(34)33(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h9-10,15-19,23-24H,3-8,11-14,20H2,1-2H3 |
| InChIKey | CKBIUIJZJQHQJW-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |