C22H19Cl2NO2S2 — CID 6426572
ethyl 2,5-dichloro-4,6-bis[(4-methylphenyl)sulfanyl]pyridine-3-carboxylate (PubChem CID 6426572) has the molecular formula C22H19Cl2NO2S2 and a molecular weight of 464.44 g/mol. Its IUPAC name is ethyl 2,5-dichloro-4,6-bis[(4-methylphenyl)sulfanyl]pyridine-3-carboxylate.
| Compound Name | ethyl 2,5-dichloro-4,6-bis[(4-methylphenyl)sulfanyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 6426572 |
| Molecular Formula | C22H19Cl2NO2S2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | ethyl 2,5-dichloro-4,6-bis[(4-methylphenyl)sulfanyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(Cl)nc(Sc2ccc(C)cc2)c(Cl)c1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C22H19Cl2NO2S2/c1-4-27-22(26)17-19(28-15-9-5-13(2)6-10-15)18(23)21(25-20(17)24)29-16-11-7-14(3)8-12-16/h5-12H,4H2,1-3H3 |
| InChIKey | ATRGSTQSGHXANN-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|