C26H58O7Si4 — CID 6427367
[(2R,5R)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl] 2-propylpentanoate (PubChem CID 6427367) has the molecular formula C26H58O7Si4 and a molecular weight of 595.09 g/mol. Its IUPAC name is [(2R,5R)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl] 2-propylpentanoate.
| Compound Name | [(2R,5R)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl] 2-propylpentanoate |
|---|---|
| PubChem CID | 6427367 |
| Molecular Formula | C26H58O7Si4 |
| Molecular Weight | 595.09 g/mol |
| Exact Mass | 594.33 |
| IUPAC Name | [(2R,5R)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl] 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)O[C@H]1OC(CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C26H58O7Si4/c1-15-17-20(18-16-2)25(27)30-26-24(33-37(12,13)14)23(32-36(9,10)11)22(31-35(6,7)8)21(29-26)19-28-34(3,4)5/h20-24,26H,15-19H2,1-14H3/t21?,22-,23?,24?,26-/m1/s1 |
| InChIKey | OVXMRISJDUWFKB-HGQHCNMCSA-N |
| XLogP | 6.98 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.09 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|