C12H18F3NO5 — CID 6430287
dipropan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]butanedioate (PubChem CID 6430287) has the molecular formula C12H18F3NO5 and a molecular weight of 313.27 g/mol. Its IUPAC name is dipropan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]butanedioate.
| Compound Name | dipropan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]butanedioate |
|---|---|
| PubChem CID | 6430287 |
| Molecular Formula | C12H18F3NO5 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | dipropan-2-yl 2-[(2,2,2-trifluoroacetyl)amino]butanedioate |
| SMILES | CC(C)OC(=O)CC(NC(=O)C(F)(F)F)C(=O)OC(C)C |
| InChI | InChI=1S/C12H18F3NO5/c1-6(2)20-9(17)5-8(10(18)21-7(3)4)16-11(19)12(13,14)15/h6-8H,5H2,1-4H3,(H,16,19) |
| InChIKey | QAUKOKHHJRWFLV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |