C15H19NO8S2 — CID 643232
O-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl] (4-nitrophenyl)methylsulfanylmethanethioate (PubChem CID 643232) has the molecular formula C15H19NO8S2 and a molecular weight of 405.45 g/mol. Its IUPAC name is O-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl] (4-nitrophenyl)methylsulfanylmethanethioate.
| Compound Name | O-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl] (4-nitrophenyl)methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 643232 |
| Molecular Formula | C15H19NO8S2 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | O-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl] (4-nitrophenyl)methylsulfanylmethanethioate |
| SMILES | CO[C@H]1O[C@H](COC(=S)SCc2ccc([N+](=O)[O-])cc2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H19NO8S2/c1-22-14-13(19)12(18)11(17)10(24-14)6-23-15(25)26-7-8-2-4-9(5-3-8)16(20)21/h2-5,10-14,17-19H,6-7H2,1H3/t10-,11-,12+,13-,14+/m1/s1 |
| InChIKey | QGIKTRXNXISOSU-RGDJUOJXSA-N |
| XLogP | 0.58 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|