C24H21N5O — CID 6435280
2-[(E)-2-[4-(4-carbamimidoylphenoxy)phenyl]ethenyl]-1H-indole-6-carboximidamide (PubChem CID 6435280) has the molecular formula C24H21N5O and a molecular weight of 395.47 g/mol. Its IUPAC name is 2-[(E)-2-[4-(4-carbamimidoylphenoxy)phenyl]ethenyl]-1H-indole-6-carboximidamide.
| Compound Name | 2-[(E)-2-[4-(4-carbamimidoylphenoxy)phenyl]ethenyl]-1H-indole-6-carboximidamide |
|---|---|
| PubChem CID | 6435280 |
| Molecular Formula | C24H21N5O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-[(E)-2-[4-(4-carbamimidoylphenoxy)phenyl]ethenyl]-1H-indole-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Oc2ccc(/C=C/c3cc4ccc(/C(N)=N/[H])cc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C24H21N5O/c25-23(26)16-6-11-21(12-7-16)30-20-9-2-15(3-10-20)1-8-19-13-17-4-5-18(24(27)28)14-22(17)29-19/h1-14,29H,(H3,25,26)(H3,27,28)/b8-1+ |
| InChIKey | YKVHMCUFFLUYBW-UNXLUWIOSA-N |
| XLogP | 4.70 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|