About diethyl-[(E)-3-oxo-4,4-diphenylbut-1-enyl]azanium;(Z)-4-hydroxy-4-oxobut-2-enoate
diethyl-[(E)-3-oxo-4,4-diphenylbut-1-enyl]azanium;(Z)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 6435613) has the molecular formula C24H27NO5
and a molecular weight of 409.48 g/mol. Its IUPAC name is diethyl-[(E)-3-oxo-4,4-diphenylbut-1-enyl]azanium;(Z)-4-hydroxy-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | diethyl-[(E)-3-oxo-4,4-diphenylbut-1-enyl]azanium;(Z)-4-hydroxy-4-oxobut-2-enoate |
| PubChem CID | 6435613 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | diethyl-[(E)-3-oxo-4,4-diphenylbut-1-enyl]azanium;(Z)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | CC[NH+](/C=C/C(=O)C(c1ccccc1)c1ccccc1)CC.O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C20H23NO.C4H4O4/c1-3-21(4-2)16-15-19(22)20(17-11-7-5-8-12-17)18-13-9-6-10-14-18;5-3(6)1-2-4(7)8/h5-16,20H,3-4H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b16-15+;2-1- |
| InChIKey | MYUKSIAXDWQGPM-QIFPAGTOSA-N |
| XLogP | 1.20 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl-[(E)-3-oxo-4,4-diphenylbut-1-enyl]azanium;(Z)-4-hydroxy-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-[(E)-3-oxo-4,4-diphenylbut-1-enyl]azanium;(Z)-4-hydroxy-4-oxobut-2-enoate?
The IUPAC name of diethyl-[(E)-3-oxo-4,4-diphenylbut-1-enyl]azanium;(Z)-4-hydroxy-4-oxobut-2-enoate (CID 6435613) is diethyl-[(E)-3-oxo-4,4-diphenylbut-1-enyl]azanium;(Z)-4-hydroxy-4-oxobut-2-enoate.
What is the SMILES notation for diethyl-[(E)-3-oxo-4,4-diphenylbut-1-enyl]azanium;(Z)-4-hydroxy-4-oxobut-2-enoate?
The canonical SMILES for diethyl-[(E)-3-oxo-4,4-diphenylbut-1-enyl]azanium;(Z)-4-hydroxy-4-oxobut-2-enoate is CC[NH+](/C=C/C(=O)C(c1ccccc1)c1ccccc1)CC.O=C([O-])/C=C\C(=O)O.
What is the InChIKey of diethyl-[(E)-3-oxo-4,4-diphenylbut-1-enyl]azanium;(Z)-4-hydroxy-4-oxobut-2-enoate?
The InChIKey is MYUKSIAXDWQGPM-QIFPAGTOSA-N. The full InChI is InChI=1S/C20H23NO.C4H4O4/c1-3-21(4-2)16-15-19(22)20(17-11-7-5-8-12-17)18-13-9-6-10-14-18;5-3(6)1-2-4(7)8/h5-16,20H,3-4H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b16-15+;2-1-.
What are the key properties of diethyl-[(E)-3-oxo-4,4-diphenylbut-1-enyl]azanium;(Z)-4-hydroxy-4-oxobut-2-enoate?
diethyl-[(E)-3-oxo-4,4-diphenylbut-1-enyl]azanium;(Z)-4-hydroxy-4-oxobut-2-enoate has a molecular weight of 409.48 g/mol, XLogP of 1.20, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-[(E)-3-oxo-4,4-diphenylbut-1-enyl]azanium;(Z)-4-hydroxy-4-oxobut-2-enoate is sourced from PubChem (CID 6435613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).