C26H31NO5 — CID 6438262
(Z)-but-2-enedioic acid;1-ethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyloxy)piperidine (PubChem CID 6438262) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-ethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyloxy)piperidine.
| Compound Name | (Z)-but-2-enedioic acid;1-ethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyloxy)piperidine |
|---|---|
| PubChem CID | 6438262 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-ethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyloxy)piperidine |
| SMILES | CCN1CCCC(OC2c3ccccc3CCc3ccccc32)C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C22H27NO.C4H4O4/c1-2-23-15-7-10-19(16-23)24-22-20-11-5-3-8-17(20)13-14-18-9-4-6-12-21(18)22;5-3(6)1-2-4(7)8/h3-6,8-9,11-12,19,22H,2,7,10,13-16H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | BZHHGBACLRWJDU-BTJKTKAUSA-N |
| XLogP | 4.09 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|