C30H36N2O9 — CID 6446164
2-(4-benzylpiperazin-1-yl)-1-(2,3-dihydro-1H-inden-5-yl)ethanol;bis((Z)-but-2-enedioic acid) (PubChem CID 6446164) has the molecular formula C30H36N2O9 and a molecular weight of 568.62 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-1-(2,3-dihydro-1H-inden-5-yl)ethanol;bis((Z)-but-2-enedioic acid).
| Compound Name | 2-(4-benzylpiperazin-1-yl)-1-(2,3-dihydro-1H-inden-5-yl)ethanol;bis((Z)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 6446164 |
| Molecular Formula | C30H36N2O9 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-1-(2,3-dihydro-1H-inden-5-yl)ethanol;bis((Z)-but-2-enedioic acid) |
| SMILES | O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O.OC(CN1CCN(Cc2ccccc2)CC1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C22H28N2O.2C4H4O4/c25-22(21-10-9-19-7-4-8-20(19)15-21)17-24-13-11-23(12-14-24)16-18-5-2-1-3-6-18;2*5-3(6)1-2-4(7)8/h1-3,5-6,9-10,15,22,25H,4,7-8,11-14,16-17H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | HRSGTMJHMVJSML-SPIKMXEPSA-N |
| XLogP | 2.45 |
| TPSA | 175.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|