C20H18N4O8 — CID 6447600
(5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-(2-methoxy-4-nitrophenyl)-2-methylimidazol-4-one (PubChem CID 6447600) has the molecular formula C20H18N4O8 and a molecular weight of 442.38 g/mol. Its IUPAC name is (5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-(2-methoxy-4-nitrophenyl)-2-methylimidazol-4-one.
| Compound Name | (5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-(2-methoxy-4-nitrophenyl)-2-methylimidazol-4-one |
|---|---|
| PubChem CID | 6447600 |
| Molecular Formula | C20H18N4O8 |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | (5Z)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-3-(2-methoxy-4-nitrophenyl)-2-methylimidazol-4-one |
| SMILES | COc1cc(/C=C2\N=C(C)N(c3ccc([N+](=O)[O-])cc3OC)C2=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H18N4O8/c1-11-21-14(7-12-8-18(31-3)19(32-4)10-16(12)24(28)29)20(25)22(11)15-6-5-13(23(26)27)9-17(15)30-2/h5-10H,1-4H3/b14-7- |
| InChIKey | DYHUJHPEAXIVBS-AUWJEWJLSA-N |
| XLogP | 3.33 |
| TPSA | 146.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|