C12H13ClF2 — CID 64506874
4-(3-chloro-3-cyclopropylpropyl)-1,2-difluorobenzene (PubChem CID 64506874) has the molecular formula C12H13ClF2 and a molecular weight of 230.68 g/mol. Its IUPAC name is 4-(3-chloro-3-cyclopropylpropyl)-1,2-difluorobenzene.
| Compound Name | 4-(3-chloro-3-cyclopropylpropyl)-1,2-difluorobenzene |
|---|---|
| PubChem CID | 64506874 |
| Molecular Formula | C12H13ClF2 |
| Molecular Weight | 230.68 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 4-(3-chloro-3-cyclopropylpropyl)-1,2-difluorobenzene |
| SMILES | Fc1ccc(CCC(Cl)C2CC2)cc1F |
| InChI | InChI=1S/C12H13ClF2/c13-10(9-3-4-9)5-1-8-2-6-11(14)12(15)7-8/h2,6-7,9-10H,1,3-5H2 |
| InChIKey | SLQBOGLLNZRWLL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|