About acetyl(amino)cyanamide
acetyl(amino)cyanamide (PubChem CID 6452580) has the molecular formula C3H5N3O
and a molecular weight of 99.09 g/mol. Its IUPAC name is acetyl(amino)cyanamide.
Molecular Properties
| Compound Name | acetyl(amino)cyanamide |
| PubChem CID | 6452580 |
| Molecular Formula | C3H5N3O |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.04 |
| IUPAC Name | acetyl(amino)cyanamide |
| SMILES | CC(=O)N(N)C#N |
| InChI | InChI=1S/C3H5N3O/c1-3(7)6(5)2-4/h5H2,1H3 |
| InChIKey | UKUXRZAZXHZIIX-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetyl(amino)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl(amino)cyanamide?
The IUPAC name of acetyl(amino)cyanamide (CID 6452580) is acetyl(amino)cyanamide.
What is the SMILES notation for acetyl(amino)cyanamide?
The canonical SMILES for acetyl(amino)cyanamide is CC(=O)N(N)C#N.
What is the InChIKey of acetyl(amino)cyanamide?
The InChIKey is UKUXRZAZXHZIIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3O/c1-3(7)6(5)2-4/h5H2,1H3.
What are the key properties of acetyl(amino)cyanamide?
acetyl(amino)cyanamide has a molecular weight of 99.09 g/mol, XLogP of -0.81, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl(amino)cyanamide is sourced from PubChem (CID 6452580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).