C15H22N4O — CID 64529978
2,6,6-trimethyl-1-[2-(1H-1,2,4-triazol-5-yl)ethyl]-5,7-dihydro-4H-indol-4-ol (PubChem CID 64529978) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 2,6,6-trimethyl-1-[2-(1H-1,2,4-triazol-5-yl)ethyl]-5,7-dihydro-4H-indol-4-ol.
| Compound Name | 2,6,6-trimethyl-1-[2-(1H-1,2,4-triazol-5-yl)ethyl]-5,7-dihydro-4H-indol-4-ol |
|---|---|
| PubChem CID | 64529978 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2,6,6-trimethyl-1-[2-(1H-1,2,4-triazol-5-yl)ethyl]-5,7-dihydro-4H-indol-4-ol |
| SMILES | Cc1cc2c(n1CCc1ncn[nH]1)CC(C)(C)CC2O |
| InChI | InChI=1S/C15H22N4O/c1-10-6-11-12(7-15(2,3)8-13(11)20)19(10)5-4-14-16-9-17-18-14/h6,9,13,20H,4-5,7-8H2,1-3H3,(H,16,17,18) |
| InChIKey | XWAKQFRCQSBARR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |