C10H19NO3S — CID 64551944
3-ethyl-3-methyl-4,4a,5,7,8,8a-hexahydro-2H-thiopyrano[4,3-b][1,4]oxazine 6,6-dioxide (PubChem CID 64551944) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is 3-ethyl-3-methyl-4,4a,5,7,8,8a-hexahydro-2H-thiopyrano[4,3-b][1,4]oxazine 6,6-dioxide.
| Compound Name | 3-ethyl-3-methyl-4,4a,5,7,8,8a-hexahydro-2H-thiopyrano[4,3-b][1,4]oxazine 6,6-dioxide |
|---|---|
| PubChem CID | 64551944 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-ethyl-3-methyl-4,4a,5,7,8,8a-hexahydro-2H-thiopyrano[4,3-b][1,4]oxazine 6,6-dioxide |
| SMILES | CCC1(C)COC2CCS(=O)(=O)CC2N1 |
| InChI | InChI=1S/C10H19NO3S/c1-3-10(2)7-14-9-4-5-15(12,13)6-8(9)11-10/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | BIHNMEOQKMDFBH-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |