C9H17NO2S2 — CID 66228290
2,2-dimethyl-3,4a,5,7,8,8a-hexahydro-1H-thiopyrano[3,4-b][1,4]thiazine 6,6-dioxide (PubChem CID 66228290) has the molecular formula C9H17NO2S2 and a molecular weight of 235.37 g/mol. Its IUPAC name is 2,2-dimethyl-3,4a,5,7,8,8a-hexahydro-1H-thiopyrano[3,4-b][1,4]thiazine 6,6-dioxide.
| Compound Name | 2,2-dimethyl-3,4a,5,7,8,8a-hexahydro-1H-thiopyrano[3,4-b][1,4]thiazine 6,6-dioxide |
|---|---|
| PubChem CID | 66228290 |
| Molecular Formula | C9H17NO2S2 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 2,2-dimethyl-3,4a,5,7,8,8a-hexahydro-1H-thiopyrano[3,4-b][1,4]thiazine 6,6-dioxide |
| SMILES | CC1(C)CSC2CS(=O)(=O)CCC2N1 |
| InChI | InChI=1S/C9H17NO2S2/c1-9(2)6-13-8-5-14(11,12)4-3-7(8)10-9/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | CVJFCRHCLIVWSN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |