C10H9Cl2N3O3S — CID 64608033
5,6-dichloro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]pyridine-3-sulfonamide (PubChem CID 64608033) has the molecular formula C10H9Cl2N3O3S and a molecular weight of 322.17 g/mol. Its IUPAC name is 5,6-dichloro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64608033 |
| Molecular Formula | C10H9Cl2N3O3S |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | 5,6-dichloro-N-[(3-methyl-1,2-oxazol-5-yl)methyl]pyridine-3-sulfonamide |
| SMILES | Cc1cc(CNS(=O)(=O)c2cnc(Cl)c(Cl)c2)on1 |
| InChI | InChI=1S/C10H9Cl2N3O3S/c1-6-2-7(18-15-6)4-14-19(16,17)8-3-9(11)10(12)13-5-8/h2-3,5,14H,4H2,1H3 |
| InChIKey | RZVDYMAUTXJZEH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|