About 3-(6-amino-4-phenyl-4,5-dihydropyridazin-3-yl)benzonitrile
3-(6-amino-4-phenyl-4,5-dihydropyridazin-3-yl)benzonitrile (PubChem CID 64691379) has the molecular formula C17H14N4
and a molecular weight of 274.33 g/mol. Its IUPAC name is 3-(6-amino-4-phenyl-4,5-dihydropyridazin-3-yl)benzonitrile.
Molecular Properties
| Compound Name | 3-(6-amino-4-phenyl-4,5-dihydropyridazin-3-yl)benzonitrile |
| PubChem CID | 64691379 |
| Molecular Formula | C17H14N4 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-(6-amino-4-phenyl-4,5-dihydropyridazin-3-yl)benzonitrile |
| SMILES | N#Cc1cccc(C2=NN=C(N)CC2c2ccccc2)c1 |
| InChI | InChI=1S/C17H14N4/c18-11-12-5-4-8-14(9-12)17-15(10-16(19)20-21-17)13-6-2-1-3-7-13/h1-9,15H,10H2,(H2,19,20) |
| InChIKey | QZBBBRPLGWUIDM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 74.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6-amino-4-phenyl-4,5-dihydropyridazin-3-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-amino-4-phenyl-4,5-dihydropyridazin-3-yl)benzonitrile?
The IUPAC name of 3-(6-amino-4-phenyl-4,5-dihydropyridazin-3-yl)benzonitrile (CID 64691379) is 3-(6-amino-4-phenyl-4,5-dihydropyridazin-3-yl)benzonitrile.
What is the SMILES notation for 3-(6-amino-4-phenyl-4,5-dihydropyridazin-3-yl)benzonitrile?
The canonical SMILES for 3-(6-amino-4-phenyl-4,5-dihydropyridazin-3-yl)benzonitrile is N#Cc1cccc(C2=NN=C(N)CC2c2ccccc2)c1.
What is the InChIKey of 3-(6-amino-4-phenyl-4,5-dihydropyridazin-3-yl)benzonitrile?
The InChIKey is QZBBBRPLGWUIDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4/c18-11-12-5-4-8-14(9-12)17-15(10-16(19)20-21-17)13-6-2-1-3-7-13/h1-9,15H,10H2,(H2,19,20).
What are the key properties of 3-(6-amino-4-phenyl-4,5-dihydropyridazin-3-yl)benzonitrile?
3-(6-amino-4-phenyl-4,5-dihydropyridazin-3-yl)benzonitrile has a molecular weight of 274.33 g/mol, XLogP of 2.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-amino-4-phenyl-4,5-dihydropyridazin-3-yl)benzonitrile is sourced from PubChem (CID 64691379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).