C14H15BrN2O3 — CID 6472928
2-[4-bromo-2-[(furan-2-ylmethylamino)methyl]phenoxy]acetamide (PubChem CID 6472928) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is 2-[4-bromo-2-[(furan-2-ylmethylamino)methyl]phenoxy]acetamide.
| Compound Name | 2-[4-bromo-2-[(furan-2-ylmethylamino)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 6472928 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 2-[4-bromo-2-[(furan-2-ylmethylamino)methyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(Br)cc1CNCc1ccco1 |
| InChI | InChI=1S/C14H15BrN2O3/c15-11-3-4-13(20-9-14(16)18)10(6-11)7-17-8-12-2-1-5-19-12/h1-6,17H,7-9H2,(H2,16,18) |
| InChIKey | NTFGMCBWOQESPG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |