C14H18N2OS2 — CID 64743489
3-(3,4-dimethylcyclohexyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 64743489) has the molecular formula C14H18N2OS2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-(3,4-dimethylcyclohexyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(3,4-dimethylcyclohexyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 64743489 |
| Molecular Formula | C14H18N2OS2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 3-(3,4-dimethylcyclohexyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CC1CCC(n2c(=S)[nH]c3sccc3c2=O)CC1C |
| InChI | InChI=1S/C14H18N2OS2/c1-8-3-4-10(7-9(8)2)16-13(17)11-5-6-19-12(11)15-14(16)18/h5-6,8-10H,3-4,7H2,1-2H3,(H,15,18) |
| InChIKey | AYHHEOHTGBTPGI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|