C17H32O3 — CID 6476240
(E,8S)-10-hydroxy-4,8-dimethyl-2-pentan-2-yldec-4-enoic acid (PubChem CID 6476240) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is (E,8S)-10-hydroxy-4,8-dimethyl-2-pentan-2-yldec-4-enoic acid.
| Compound Name | (E,8S)-10-hydroxy-4,8-dimethyl-2-pentan-2-yldec-4-enoic acid |
|---|---|
| PubChem CID | 6476240 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | (E,8S)-10-hydroxy-4,8-dimethyl-2-pentan-2-yldec-4-enoic acid |
| SMILES | CCCC(C)C(C/C(C)=C/CC[C@H](C)CCO)C(=O)O |
| InChI | InChI=1S/C17H32O3/c1-5-7-15(4)16(17(19)20)12-14(3)9-6-8-13(2)10-11-18/h9,13,15-16,18H,5-8,10-12H2,1-4H3,(H,19,20)/b14-9+/t13-,15?,16?/m0/s1 |
| InChIKey | XPYZTOJIOLCDPV-WKIOLGRYSA-N |
| XLogP | 4.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|