About (2R)-2-amino-3-[(E)-3,7-dimethyldec-6-enyl]sulfanylpropanoic acid
(2R)-2-amino-3-[(E)-3,7-dimethyldec-6-enyl]sulfanylpropanoic acid (PubChem CID 143996574) has the molecular formula C15H29NO2S
and a molecular weight of 287.47 g/mol. Its IUPAC name is (2R)-2-amino-3-[(E)-3,7-dimethyldec-6-enyl]sulfanylpropanoic acid.
Molecular Properties
| Compound Name | (2R)-2-amino-3-[(E)-3,7-dimethyldec-6-enyl]sulfanylpropanoic acid |
| PubChem CID | 143996574 |
| Molecular Formula | C15H29NO2S |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (2R)-2-amino-3-[(E)-3,7-dimethyldec-6-enyl]sulfanylpropanoic acid |
| SMILES | CCC/C(C)=C/CCC(C)CCSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C15H29NO2S/c1-4-6-12(2)7-5-8-13(3)9-10-19-11-14(16)15(17)18/h7,13-14H,4-6,8-11,16H2,1-3H3,(H,17,18)/b12-7+/t13?,14-/m0/s1 |
| InChIKey | FOROSYYSHVRCAB-WEWUPFQBSA-N |
| XLogP | 3.68 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-3-[(E)-3,7-dimethyldec-6-enyl]sulfanylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3-[(E)-3,7-dimethyldec-6-enyl]sulfanylpropanoic acid?
The IUPAC name of (2R)-2-amino-3-[(E)-3,7-dimethyldec-6-enyl]sulfanylpropanoic acid (CID 143996574) is (2R)-2-amino-3-[(E)-3,7-dimethyldec-6-enyl]sulfanylpropanoic acid.
What is the SMILES notation for (2R)-2-amino-3-[(E)-3,7-dimethyldec-6-enyl]sulfanylpropanoic acid?
The canonical SMILES for (2R)-2-amino-3-[(E)-3,7-dimethyldec-6-enyl]sulfanylpropanoic acid is CCC/C(C)=C/CCC(C)CCSC[C@H](N)C(=O)O.
What is the InChIKey of (2R)-2-amino-3-[(E)-3,7-dimethyldec-6-enyl]sulfanylpropanoic acid?
The InChIKey is FOROSYYSHVRCAB-WEWUPFQBSA-N. The full InChI is InChI=1S/C15H29NO2S/c1-4-6-12(2)7-5-8-13(3)9-10-19-11-14(16)15(17)18/h7,13-14H,4-6,8-11,16H2,1-3H3,(H,17,18)/b12-7+/t13?,14-/m0/s1.
What are the key properties of (2R)-2-amino-3-[(E)-3,7-dimethyldec-6-enyl]sulfanylpropanoic acid?
(2R)-2-amino-3-[(E)-3,7-dimethyldec-6-enyl]sulfanylpropanoic acid has a molecular weight of 287.47 g/mol, XLogP of 3.68, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-[(E)-3,7-dimethyldec-6-enyl]sulfanylpropanoic acid is sourced from PubChem (CID 143996574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).