C14H19N3OS — CID 64806382
4-(1H-benzimidazol-2-ylsulfanyl)-2-(cyclopropylamino)butan-1-ol (PubChem CID 64806382) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanyl)-2-(cyclopropylamino)butan-1-ol.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanyl)-2-(cyclopropylamino)butan-1-ol |
|---|---|
| PubChem CID | 64806382 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanyl)-2-(cyclopropylamino)butan-1-ol |
| SMILES | OCC(CCSc1nc2ccccc2[nH]1)NC1CC1 |
| InChI | InChI=1S/C14H19N3OS/c18-9-11(15-10-5-6-10)7-8-19-14-16-12-3-1-2-4-13(12)17-14/h1-4,10-11,15,18H,5-9H2,(H,16,17) |
| InChIKey | OSJUCGWWHUKYGW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |