C16H23N3OSe — CID 64850981
N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2,1,3-benzoselenadiazol-4-amine (PubChem CID 64850981) has the molecular formula C16H23N3OSe and a molecular weight of 352.34 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 64850981 |
| Molecular Formula | C16H23N3OSe |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-2,1,3-benzoselenadiazol-4-amine |
| SMILES | CC(C)COC1CC(Nc2cccc3n[se]nc23)C1(C)C |
| InChI | InChI=1S/C16H23N3OSe/c1-10(2)9-20-14-8-13(16(14,3)4)17-11-6-5-7-12-15(11)19-21-18-12/h5-7,10,13-14,17H,8-9H2,1-4H3 |
| InChIKey | IUMPTLOSKNQVTF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|