C17H21N3 — CID 64857270
3-phenyl-1-(pyridin-4-ylmethyl)-1,4-diazepane (PubChem CID 64857270) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 3-phenyl-1-(pyridin-4-ylmethyl)-1,4-diazepane.
| Compound Name | 3-phenyl-1-(pyridin-4-ylmethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64857270 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 3-phenyl-1-(pyridin-4-ylmethyl)-1,4-diazepane |
| SMILES | c1ccc(C2CN(Cc3ccncc3)CCCN2)cc1 |
| InChI | InChI=1S/C17H21N3/c1-2-5-16(6-3-1)17-14-20(12-4-9-19-17)13-15-7-10-18-11-8-15/h1-3,5-8,10-11,17,19H,4,9,12-14H2 |
| InChIKey | ADZFZQZWBFBUDJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |