C14H18F4N2 — CID 106294194
3-phenyl-1-(2,2,3,3-tetrafluoropropyl)-1,4-diazepane (PubChem CID 106294194) has the molecular formula C14H18F4N2 and a molecular weight of 290.30 g/mol. Its IUPAC name is 3-phenyl-1-(2,2,3,3-tetrafluoropropyl)-1,4-diazepane.
| Compound Name | 3-phenyl-1-(2,2,3,3-tetrafluoropropyl)-1,4-diazepane |
|---|---|
| PubChem CID | 106294194 |
| Molecular Formula | C14H18F4N2 |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 3-phenyl-1-(2,2,3,3-tetrafluoropropyl)-1,4-diazepane |
| SMILES | FC(F)C(F)(F)CN1CCCNC(c2ccccc2)C1 |
| InChI | InChI=1S/C14H18F4N2/c15-13(16)14(17,18)10-20-8-4-7-19-12(9-20)11-5-2-1-3-6-11/h1-3,5-6,12-13,19H,4,7-10H2 |
| InChIKey | LXXNBILHSXQTRV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|