C13H16N2O3S2 — CID 64905373
N-(4-carbamothioylphenyl)-N-methyl-1,1-dioxothiolane-3-carboxamide (PubChem CID 64905373) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is N-(4-carbamothioylphenyl)-N-methyl-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(4-carbamothioylphenyl)-N-methyl-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 64905373 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | N-(4-carbamothioylphenyl)-N-methyl-1,1-dioxothiolane-3-carboxamide |
| SMILES | CN(C(=O)C1CCS(=O)(=O)C1)c1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C13H16N2O3S2/c1-15(11-4-2-9(3-5-11)12(14)19)13(16)10-6-7-20(17,18)8-10/h2-5,10H,6-8H2,1H3,(H2,14,19) |
| InChIKey | LCJOKGAMJCWAIJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|