C15H21BrF2N2 — CID 64945368
1-(2-bromo-4,6-difluorophenyl)-3,3-diethyl-1,4-diazepane (PubChem CID 64945368) has the molecular formula C15H21BrF2N2 and a molecular weight of 347.25 g/mol. Its IUPAC name is 1-(2-bromo-4,6-difluorophenyl)-3,3-diethyl-1,4-diazepane.
| Compound Name | 1-(2-bromo-4,6-difluorophenyl)-3,3-diethyl-1,4-diazepane |
|---|---|
| PubChem CID | 64945368 |
| Molecular Formula | C15H21BrF2N2 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-(2-bromo-4,6-difluorophenyl)-3,3-diethyl-1,4-diazepane |
| SMILES | CCC1(CC)CN(c2c(F)cc(F)cc2Br)CCCN1 |
| InChI | InChI=1S/C15H21BrF2N2/c1-3-15(4-2)10-20(7-5-6-19-15)14-12(16)8-11(17)9-13(14)18/h8-9,19H,3-7,10H2,1-2H3 |
| InChIKey | YQIPWARHEMKVLD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |