C11H25NO3S — CID 65012689
3-methyl-2-(3-methylbutoxymethyl)butane-1-sulfonamide (PubChem CID 65012689) has the molecular formula C11H25NO3S and a molecular weight of 251.39 g/mol. Its IUPAC name is 3-methyl-2-(3-methylbutoxymethyl)butane-1-sulfonamide.
| Compound Name | 3-methyl-2-(3-methylbutoxymethyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 65012689 |
| Molecular Formula | C11H25NO3S |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 3-methyl-2-(3-methylbutoxymethyl)butane-1-sulfonamide |
| SMILES | CC(C)CCOCC(CS(N)(=O)=O)C(C)C |
| InChI | InChI=1S/C11H25NO3S/c1-9(2)5-6-15-7-11(10(3)4)8-16(12,13)14/h9-11H,5-8H2,1-4H3,(H2,12,13,14) |
| InChIKey | SLZJECPXPUDDOK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|