C22H21N3OS2 — CID 6502058
N-(2-methylbutan-2-yl)-2,3-di(thiophen-3-yl)quinoxaline-6-carboxamide (PubChem CID 6502058) has the molecular formula C22H21N3OS2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-(2-methylbutan-2-yl)-2,3-di(thiophen-3-yl)quinoxaline-6-carboxamide.
| Compound Name | N-(2-methylbutan-2-yl)-2,3-di(thiophen-3-yl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 6502058 |
| Molecular Formula | C22H21N3OS2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-(2-methylbutan-2-yl)-2,3-di(thiophen-3-yl)quinoxaline-6-carboxamide |
| SMILES | CCC(C)(C)NC(=O)c1ccc2nc(-c3ccsc3)c(-c3ccsc3)nc2c1 |
| InChI | InChI=1S/C22H21N3OS2/c1-4-22(2,3)25-21(26)14-5-6-17-18(11-14)24-20(16-8-10-28-13-16)19(23-17)15-7-9-27-12-15/h5-13H,4H2,1-3H3,(H,25,26) |
| InChIKey | UUTBWPYFWSWXRR-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |