C13H12ClN3 — CID 65028225
N-(2-chloro-2,3-dihydro-1H-inden-1-yl)pyridazin-3-amine (PubChem CID 65028225) has the molecular formula C13H12ClN3 and a molecular weight of 245.71 g/mol. Its IUPAC name is N-(2-chloro-2,3-dihydro-1H-inden-1-yl)pyridazin-3-amine.
| Compound Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 65028225 |
| Molecular Formula | C13H12ClN3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)pyridazin-3-amine |
| SMILES | ClC1Cc2ccccc2C1Nc1cccnn1 |
| InChI | InChI=1S/C13H12ClN3/c14-11-8-9-4-1-2-5-10(9)13(11)16-12-6-3-7-15-17-12/h1-7,11,13H,8H2,(H,16,17) |
| InChIKey | YPJATNWKTQGATJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|