C15H16ClN3 — CID 65028479
N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-2,6-dimethylpyrimidin-4-amine (PubChem CID 65028479) has the molecular formula C15H16ClN3 and a molecular weight of 273.77 g/mol. Its IUPAC name is N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-2,6-dimethylpyrimidin-4-amine.
| Compound Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-2,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 65028479 |
| Molecular Formula | C15H16ClN3 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-2,6-dimethylpyrimidin-4-amine |
| SMILES | Cc1cc(NC2c3ccccc3CC2Cl)nc(C)n1 |
| InChI | InChI=1S/C15H16ClN3/c1-9-7-14(18-10(2)17-9)19-15-12-6-4-3-5-11(12)8-13(15)16/h3-7,13,15H,8H2,1-2H3,(H,17,18,19) |
| InChIKey | YHVJWPTVFQNISE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|